Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)c1ccc2ncnc(NCC(=O)NC3CN(C3)[C@@H]4CC[C@@H](CC4)N5CCCCO5)c2c1
Formula C24H31F3N6O2
Molecular Weight 492.54 da
Stereocenters 2/2