Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)c1ccc2ncnc(NCC(=O)NC3CN(C3)C4CCC(CC4)N5CCCC5=O)c2c1
Formula C24H29F3N6O2
Molecular Weight 490.52 da
Stereocenters 0/0