Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)c1ccc2ncnc(NCC(=O)NC3CN(C3)[C@@H]4CC[C@@H](CC4)C5CNC(=O)O5)c2c1
Formula C23H27F3N6O3
Molecular Weight 492.49 da
Stereocenters 2/3