Molecular Definition

Canonical SMILES Cc1c2COC(=O)c2ccc1[C@@H](O)CNC3C[C@H]4C[C@@H]3N(C[C@H](O)c5ccc6C(=O)OCc6c5C)C4
Formula C28H32N2O6
Molecular Weight 492.56 da
Stereocenters 4/5