Molecular Definition

Canonical SMILES Cc1c2COC(=O)c2ccc1[C@@H](O)CN3CC[C@H](C3)NS(=O)(=O)c4ccc(cc4)[N+]#[C-]
Formula C22H23N3O5S
Molecular Weight 441.50 da
Stereocenters 2/2