Molecular Definition

Canonical SMILES Cc1c2COC(=O)c2ccc1[C@@H](O)CN3CC[C@H](C3)NCC(O)c4ccc(cn4)C#N
Formula C23H26N4O4
Molecular Weight 422.48 da
Stereocenters 2/3