Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1C)C(=O)N[C@H](C)c2cccc(c2)C(=O)Nc3nc4CCN(C)Cc4s3
Formula C25H28N4O3S
Molecular Weight 464.58 da
Stereocenters 1/1