Molecular Definition

Canonical SMILES COC(=O)[C@H]1CCCC(C1)C(=O)N2CC[C@]3(C)c4ccccc4C[C@@H]2C3(C)C
Formula C24H33NO3
Molecular Weight 383.52 da
Stereocenters 3/4