Molecular Definition

Canonical SMILES C[C@H]1[C@H]2Cc3ccccc3[C@]1(C)CCN2C(=O)[C@@H]4COc5ccccc5O4
Formula C23H25NO3
Molecular Weight 363.45 da
Stereocenters 4/4