Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc(nc1)c2nnc3[C@H]4CCC[C@@H](Cn23)N4C(=O)c5cccc(c5Cl)C(F)(F)F
Formula C21H16ClF4N5O
Molecular Weight 465.83 da
Stereocenters 2/2