Molecular Definition

Canonical SMILES CC(C)(C)C(=O)CS(=O)(=O)c1ccccc1c2ccc(c(F)c2)c3cnc(N)nc3
Formula C22H22FN3O3S
Molecular Weight 427.49 da
Stereocenters 0/0