Target Relevance

Molecular Definition

Canonical SMILES CC(Cc1ccc(cc1)C#Cc2cnc(NCCc3ccccc3)nc2)NC(=O)C
Formula C25H26N4O
Molecular Weight 398.50 da
Stereocenters 0/1