Molecular Definition

Canonical SMILES Nc1ncc(cn1)c2ccc(cc2F)c3ccccc3S(=O)(=O)N4CCNCC4
Formula C20H20FN5O2S
Molecular Weight 413.47 da
Stereocenters 0/0