Target Relevance

Molecular Definition

Canonical SMILES CCCN(CCO)Cc1c(nc2cc(\C=C\C(=O)NO)ccn12)c3ccccc3
Formula C22H26N4O3
Molecular Weight 394.47 da
Stereocenters 0/0