Molecular Definition

Canonical SMILES Fc1ccc(NS(=O)(=O)c2ccc(Oc3cnc(N4CCC4)c(Cl)c3)c(c2)C#N)nc1
Formula C20H15ClFN5O3S
Molecular Weight 459.88 da
Stereocenters 0/0