Target Relevance

Molecular Definition

Canonical SMILES COc1ccccc1C2N(C(=O)c3n[nH]c(c23)C(C)(C)C)c4ccc(cc4)c5onc(NC(=O)C)c5
Formula C27H27N5O4
Molecular Weight 485.53 da
Stereocenters 0/1