Target Relevance

Glucagon Tchem
pKi 70819 6.03

Molecular Definition

Canonical SMILES OC(=O)CCNC(=O)c1ccc(cc1)C(CC(F)(F)F)Nc2cnc3ccccc3c2
Formula C22H20F3N3O3
Molecular Weight 431.41 da
Stereocenters 0/1