Target Relevance

Glucagon Tchem
pKi 70819 6.32

Molecular Definition

Canonical SMILES CC(C)CC(Nc1ccc2ccc(cc2n1)C(F)(F)F)c3ccc(cc3)C(=O)NCCC(=O)O
Formula C25H26F3N3O3
Molecular Weight 473.49 da
Stereocenters 0/1