Target Relevance

Glucagon Tchem
pKi 70819 6.28

Molecular Definition

Canonical SMILES CC(C)CC(Nc1cc2ccccc2cn1)c3ccc(cc3)C(=O)NCCC(=O)O
Formula C24H27N3O3
Molecular Weight 405.49 da
Stereocenters 0/1