Target Relevance

Glucagon Tchem
pKi 70819 6.01

Molecular Definition

Canonical SMILES CC(C)CC(Nc1nc2ccccc2nc1C)c3ccc(cc3)C(=O)NCCC(=O)O
Formula C24H28N4O3
Molecular Weight 420.50 da
Stereocenters 0/1