Target Relevance

Molecular Definition

Canonical SMILES Fc1c(cccc1C(F)(F)F)C(=O)NCC2(CCOCC2)c3ccc(Cl)cc3
Formula C20H18ClF4NO2
Molecular Weight 415.81 da
Stereocenters 0/0