Molecular Definition

Canonical SMILES Cn1cc(cn1)c2ccc(Cn3c(CC(C)(C)C(=O)O)nc4cc(OCc5ccc6ccccc6n5)ccc34)cc2
Formula C33H31N5O3
Molecular Weight 545.63 da
Stereocenters 0/0