Molecular Definition

Canonical SMILES CC(c1ccc(Br)cc1)n2c(CC(C)(C)C(=O)O)nc3cc(OCc4ccc5ccccc5n4)ccc23
Formula C30H28BrN3O3
Molecular Weight 558.47 da
Stereocenters 0/1