Molecular Definition

Canonical SMILES CC1(C)[C@H](C1c2nc3cc(OCc4ccc5ccccc5n4)ccc3n2Cc6ccc(Br)cc6)C(=O)O
Formula C30H26BrN3O3
Molecular Weight 556.45 da
Stereocenters 1/2