Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@H](NC(=O)[C@H](Cc1ccccn1)NC(=O)[C@H](CC(=O)O)NC(=O)OCc2ccccc2)C(=O)N[C@@H](CC(=O)O)\C=C\S(=O)(=O)c3ccccc3
Formula C36H41N5O11S
Molecular Weight 751.80 da
Stereocenters 4/4