Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1)c2ccccc2)C(=O)N[C@@H](CC(=O)O)\C=C\S(=O)(=O)C
Formula C31H38N4O11S
Molecular Weight 674.72 da
Stereocenters 4/4