Target Relevance

Glucagon Tchem
pKi 70819 6.11

Molecular Definition

Canonical SMILES CC(Nc1ccc(cc1)c2ccc(F)cc2)c3ccc(Cl)cc3c4ccc(cc4)C(=O)NCCC(=O)O
Formula C30H26ClFN2O3
Molecular Weight 516.99 da
Stereocenters 0/1