Molecular Definition

Canonical SMILES Nc1ccccc1NC(=O)c2ccc(CNC(=O)c3[nH]c(cc3c4cocc4)c5ccc(O)cc5)cc2
Formula C29H24N4O4
Molecular Weight 492.53 da
Stereocenters 0/0