Molecular Definition

Canonical SMILES Fc1cc(ccc1CNC(=O)c2c(Cl)cccc2Cl)C3=CC(=O)NC=C3
Formula C19H13Cl2FN2O2
Molecular Weight 391.22 da
Stereocenters 0/0