Molecular Definition

Canonical SMILES Fc1cccc(Cl)c1C(=O)NCc2ccc(cc2)C3=CC(=O)NC=C3
Formula C19H14ClFN2O2
Molecular Weight 356.78 da
Stereocenters 0/0