Molecular Definition

Canonical SMILES Cc1cc(CNC(=O)c2c(Cl)cccc2Cl)ccc1C3=CC(=O)NC=C3
Formula C20H16Cl2N2O2
Molecular Weight 387.26 da
Stereocenters 0/0