Molecular Definition

Canonical SMILES Cc1nnsc1C(=O)Nc2ccc(c(F)c2)n3nc(C4CC4)c(Cl)c3C5CC5
Formula C19H17ClFN5OS
Molecular Weight 417.89 da
Stereocenters 0/0