Molecular Definition

Canonical SMILES Cc1ncncc1C(=O)Nc2ccc(c(F)c2)n3nc(cc3C4CC4)C5CC5
Formula C21H20FN5O
Molecular Weight 377.41 da
Stereocenters 0/0