Molecular Definition

Canonical SMILES Fc1cc(NC(=O)c2ccncc2)ccc1n3nc(cc3C4CC4)C5CC5
Formula C21H19FN4O
Molecular Weight 362.40 da
Stereocenters 0/0