Molecular Definition

Canonical SMILES O=C(Cc1ccccc1)Nc2ccc(cc2)n3nc(cc3C4CC4)C5CC5
Formula C23H23N3O
Molecular Weight 357.45 da
Stereocenters 0/0