Molecular Definition

Canonical SMILES Cc1ncsc1C(=O)Nc2ccc(cc2)n3nc(cc3C4CC4)C5CC5
Formula C20H20N4OS
Molecular Weight 364.46 da
Stereocenters 0/0