Molecular Definition

Canonical SMILES COc1ccc(C\N=C\c2cc(cc(OC)c2O)c3cccs3)cc1
Formula C20H19NO3S
Molecular Weight 353.44 da
Stereocenters 0/0