Target Relevance

Molecular Definition

Canonical SMILES Cn1c2CC3CCC(N3)c2c4cc(ccc14)S(=O)(=O)c5ccccc5O
Formula C20H20N2O3S
Molecular Weight 368.45 da
Stereocenters 0/2