Target Relevance

Molecular Definition

Canonical SMILES COc1ccccc1c2ccnc3[nH]c(cc23)C4CCNCC4
Formula C19H21N3O
Molecular Weight 307.39 da
Stereocenters 0/0