Target Relevance

Molecular Definition

Canonical SMILES C[C@@H]1Cn2c(nnc2c3cnccn3)C(=O)N1Cc4cccc(c4Cl)C(F)(F)F
Formula C18H14ClF3N6O
Molecular Weight 422.79 da
Stereocenters 1/1