Molecular Definition

Canonical SMILES CC(C)c1nn(c2ccc(cc2Cl)C(=O)N)c3nccc(c13)n4cnc(c4)c5ccc(cc5)C(=O)N
Formula C26H22ClN7O2
Molecular Weight 499.95 da
Stereocenters 0/0