Target Relevance

Molecular Definition

Canonical SMILES COc1cc2CCN(C(CC(c3ccccc3)c4ccccc4)c2cc1OC)C(=O)C(F)(F)F
Formula C27H26F3NO3
Molecular Weight 469.50 da
Stereocenters 0/1