Molecular Definition

Canonical SMILES CCC(CC)n1ncc2C(=S)NC(=Nc12)CC3CCCCC3
Formula C17H26N4S
Molecular Weight 318.48 da
Stereocenters 0/0