Molecular Definition

Canonical SMILES CCC(CC)n1ncc2C(=O)NC(=Nc12)CC3CCCCC3
Formula C17H26N4O
Molecular Weight 302.41 da
Stereocenters 0/0