Molecular Definition

Canonical SMILES CS(=O)(=O)Nc1ccc(cc1)C2=COc3cc(ccc3C2=O)C#Cc4ccccc4
Formula C24H17NO4S
Molecular Weight 415.46 da
Stereocenters 0/0