Molecular Definition

Canonical SMILES COc1cc(cc(C=O)c1O)c2cccs2
Formula C12H10O3S
Molecular Weight 234.27 da
Stereocenters 0/0