Molecular Definition

Canonical SMILES NC(=N)c1ccc(CNC(=O)[C@H](CCC2CCNCC2)NC(=O)[C@@H](CCCc3ccccc3)NS(=O)(=O)Cc4ccccc4)cc1
Formula C35H46N6O4S
Molecular Weight 646.84 da
Stereocenters 2/2