Molecular Definition

Canonical SMILES Nc1cnc(cn1)c2ccc(C3CCC3)c(OCC(O)CN4CCNC4=O)c2F
Formula C20H24FN5O3
Molecular Weight 401.43 da
Stereocenters 0/1