Molecular Definition

Canonical SMILES Nc1cnc(cn1)c2ccc(C3CCC3)c(OCC(O)CO)c2F
Formula C17H20FN3O3
Molecular Weight 333.36 da
Stereocenters 0/1