Target Relevance

Molecular Definition

Canonical SMILES CC(C)C1CCC(CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(C)(F)F
Formula C24H33F2N5O
Molecular Weight 445.55 da
Stereocenters 0/0